3-Hydroxyadamantane-1-carboxylic acid is a chemical compound featuring both a carboxylic acid and a hydroxyl group on an adamantane framework. It is primarily utilized as a pharmaceutical intermediate in the synthesis of other compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 42711-75-1
1,3-Adamantanedicarboxylic acid
pharmaceutical intermediate
2-Amino-4-(trifluoromethyl)benzenethiol hydrochloride
Pharmaceutical intermediate for trifluoromethylated compounds
Flurbiprofen Related Impurity 1
Pharmaceutical impurity reference standard
5-Methylisoxazole-4-carboxylic acid
Pharmaceutical intermediate for synthesis
(R)-methyl pyrrolidine-3-carboxylate
Pharmaceutical intermediate
3-hydroxyadamantane-1-carboxylic acid
CJJMAWPEZKYJAP-UHFFFAOYSA-N
C1C2CC3(CC1CC(C2)(C3)O)C(=O)O