1,2-Dihydro Dexamethasone is a steroidal compound that serves as an active pharmaceutical ingredient. Its structure features a fused four-ring steroid framework with multiple hydroxyl groups and a fluorine atom, contributing to its chemical properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2-Dihydro Dexamethasone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Alpha-Cyclopentylmandelic acid
Glycopyrrolate related compound C reference standard
CYPROTERONE ACETATE
active pharmaceutical ingredient
Flumequine
fluoroquinolone antibiotic
Bevantolol hydrochloride
active pharmaceutical ingredient
FLUDROCORTISONE ACETATE
active pharmaceutical ingredient
Fluorogestone acetate
progestational hormone
1,2-Dihydro Dexamethasone(CAS 426-17-5)의 국제 HS 코드는 2914.79입니다.
2914.79
2914 79 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
YYZXYYHUGHQGHI-CXSFZGCWSA-N
C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C
1,2-Dihydro Dexamethasone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.