Perflubron is a perfluorocarbon-based haloalkane, specifically a bromine-substituted perfluorooctane, that serves as both a contrast agent for medical imaging and a synthetic blood substitute. Its key significance lies in its ability to carry oxygen and provide radioopacity, making it useful in diverse medical applications such as retinal detachment surgery and cell culture oxygen supply.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Perflubron 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,2,3,4-Tetramethylcyclopentadiene
precursor for cyclopentadienyl ligands
Methyltriacetoxysilane
cross-linker for silicone sealants and adhesives
4,4-Dimethylcyclohexanone
chemical research intermediate
1,3,5-Triazine, 2-(2-(4-methoxyphenyl)ethenyl)-4,6-bis(trichloromethyl)-
Photoinitiator for UV-curable coatings
Perflubron(CAS 423-55-2)의 국제 HS 코드는 2903.78입니다.
2903.78
2903 78 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane
WTWWXOGTJWMJHI-UHFFFAOYSA-N
C(C(C(C(C(F)(F)Br)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F
Perflubron 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.