This compound is an acetylated derivative of guanosine, modified with acetyl groups at the 2' and 3' positions of the ribose sugar. It is primarily used as an intermediate in the synthesis of pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 42167-65-7
Triacetylguanosine
protected guanosine derivative
Guanosine, N-acetyl-, 2',3'-diacetate
pharmaceutical intermediate
2-aminoisonicotinonitrile
Pharmaceutical intermediate for synthesis
(S)-(+)-2-butanol
Pharmaceutical intermediate
N-Ethyl-N-methylcarbamoyl chloride
Pharmaceutical intermediate synthesis
N-Trifluoroacetyl-L-lysine N-Carboxyanhydride
Pharmaceutical intermediate
[(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate
MESNVKGXLMWATF-QYVSTXNMSA-N
CC(=O)O[C@@H]1[C@H](O[C@H]([C@@H]1OC(=O)C)N2C=NC3=C2N=C(NC3=O)N)CO