This compound is a deuterium-labeled aniline derivative, specifically the pentadeuterio form of aniline, where all five aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of isotopically labeled compounds for research and development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4165-61-1
4-Piperidone
pharmaceutical intermediate
5,6-Dichloronicotinic acid
Pharmaceutical intermediate
5-Bromo-6-oxo-1,6-dihydropyridine-3-carboxylic acid
pharmaceutical intermediate
2,4-Dichlorothiazole
Pharmaceutical intermediate
ANILINE
chemical intermediate for dyes and polymers
(2H7)Aniline
Deuterated research reagent
2,3,4,5,6-pentadeuterioaniline
PAYRUJLWNCNPSJ-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N)[2H])[2H]