This compound is a deuterium-labeled aniline derivative, specifically the pentadeuterio form of aniline, where all five aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of isotopically labeled compounds for research and development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2,3,4,5,6-2H5)Aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Piperidone
pharmaceutical intermediate
5,6-Dichloronicotinic acid
Pharmaceutical intermediate
5-Bromo-6-oxo-1,6-dihydropyridine-3-carboxylic acid
pharmaceutical intermediate
2,4-Dichlorothiazole
Pharmaceutical intermediate
ANILINE
chemical intermediate for dyes and polymers
(2H7)Aniline
Deuterated research reagent
(2,3,4,5,6-2H5)Aniline(CAS 4165-61-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2,3,4,5,6-pentadeuterioaniline
PAYRUJLWNCNPSJ-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N)[2H])[2H]
(2,3,4,5,6-2H5)Aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.