This compound is a steroidal intermediate used in the synthesis of Fulvestrant, a pharmaceutical agent. It features a complex polycyclic structure with a long alkyl side chain containing both sulfur and multiple fluorine atoms, contributing to its high lipophilicity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(7R,8R,9S,10R,13S,14S,17S)-7-(9-Bromononyl)-13-methyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl acetate
research compound
(7a,17b)-7-(9-bromononyl)-estra-1,3,5(10)-triene-3,17-diol 17-acetate
Fulvestrant intermediate
(7a,17b)-7-(9-Bromononyl)estra-1,3,5(10)-triene-3,17-diol
Fulvestrant intermediate
(7alpha,17beta)-7-[9-[(4,4,5,5,5-Pentafluoropentyl)thio]nonyl]estra-1,3,5(10)-triene-3,17-diol
Fulvestrant intermediate
3,4-dihydro-6-hydroxy-7-methoxy-2,2-dimethyl-1(2h)-benzopyran
Fulvestrant intermediate
4-Bromo-2-fluoro-1,1'-biphenyl
Pharmaceutical intermediate
Allopurinol Impurity 9
Allopurinol impurity reference standard
Beta-D-Galactose pentaacetate
Pharmaceutical intermediate for carbohydrate chemistry
[(7R,8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate
VAFUQFCTCUWBQD-YPTRIRRJSA-N
CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](CC4=CC(=O)CC[C@H]34)CCCCCCCCCSCCCC(C(F)(F)F)(F)F)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.