Bis(4-allyloxyphenyl)sulfone is a sulfone compound containing two allyloxyphenyl groups connected through a sulfonyl bridge. It is primarily used as a monomer in the synthesis of specialty polymers due to its reactive allyl ether groups and rigid aromatic core.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 41481-63-4
Irganox 1035
antioxidant for polymers and lubricants
Tris(4-isocyanatophenyl) thiophosphate
polyurethane crosslinking agent
1-Bromo-4-chloro-2-nitrobenzene
Industrial intermediate for synthesis
3-Chlorobenzylamine
Chemical intermediate for synthesis
Phenol, 4,4'-sulfonylbis[2-(2-propenyl)-
sulfonic acid derivative
5,5'-Sulfonylbis(1,3-dibromo-2-(2,3-dibromopropoxy)benzene)
flame retardant additive
2,4'-Dihydroxydiphenyl sulfone
sulfone monomer for polymer synthesis
3,3'-Dinitrodiphenyl sulfone
production of 3,3-diamino diphenyl sulfone
1-prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonylbenzene
JUNVYDTYJZSTKY-UHFFFAOYSA-N
C=CCOC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)OCC=C