1-(Phenylsulfonyl)-1H-indole is a sulfonamide compound used as a pharmaceutical intermediate in chemical synthesis. It features an indole ring bonded to a phenylsulfonyl group, contributing to its role in building more complex molecules for pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 40899-71-6
Methyl 4-acetamido-5-chloro-2-methoxybenzoate
Pharmaceutical intermediate
Ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate
Pharmaceutical intermediate
4-Aminopiperidine-4-carboxylic acid
Pharmaceutical intermediate for CELMoD synthesis
N-Methyl-2,2'-diaminodiethylamine
Pharmaceutical intermediate
1-(phenylsulfonyl)-1H-indol-3-ylboronic acid
boronic acid building block
1-(benzenesulfonyl)indole
VDWLCYCWLIKWBV-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC=CC=C32