2-Fluoro-4-nitrobenzoic acid is an organic compound featuring both a carboxylic acid and a nitro group on a fluorinated aromatic ring. It is primarily used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 403-24-7
2-Fluoro-5-nitrobenzoic acid
Pharmaceutical intermediate for synthesis
Methyl 4-fluorobenzoate
Pharmaceutical intermediate
4-Fluorobenzoyl chloride
precursor to high-performance polymer PEEK
6-Fluoronicotinic acid
pharmaceutical intermediate
3-Fluorobenzonitrile
Pharmaceutical intermediate
2-fluoro-4-nitrobenzoic acid
MMWFMFZFCKADEL-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])F)C(=O)O