This compound is a pharmaceutical intermediate used in peptide synthesis, featuring a protected amino acid structure with a fluorenylmethoxycarbonyl (Fmoc) protecting group and a sulfonyl guanidine moiety. It is primarily significant as a building block for the manufacture of complex peptides in research and pharmaceutical development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine
protected arginine derivative for peptide synthesis
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-{N'-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidamido}pentanoic acid
Protected arginine building block for peptide synthesis
Fmoc-Arg(Pbf)-Ser(Psi(Me,Me)pro)-OH
protected amino acid building block
1-bromo-2-chloro-4-(trifluoromethyl)benzene
pharmaceutical intermediate
3-(Trifluoromethyl)benzyl bromide
Pharmaceutical synthesis intermediate
1-fluoro-4-(trichloromethyl)benzene
Pharmaceutical, dye, pesticide intermediate
4-Bromobenzotrifluoride
Pharmaceutical intermediate
(3S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
SPUZTADXOCHTJW-QHCPKHFHSA-N
CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.