Trideuteriomethoxybenzene is a deuterated research standard, where the methoxy group contains three deuterium atoms. It is used as a labeled compound in analytical chemistry and mass spectrometry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4019-63-0
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-(Trifluoromethyl)benzyl bromide
research compound
5-Methyl-1H-pyrazole-3-carboxylic acid
research compound
6-Fluoropyridine-2-carboxylic acid
Research compound
아니솔
solvent and heat transfer medium
trideuteriomethoxybenzene
RDOXTESZEPMUJZ-FIBGUPNXSA-N
[2H]C([2H])([2H])OC1=CC=CC=C1