(4-Benzamidophenyl)boronic acid is a boronic acid derivative used as a pharmaceutical intermediate. Its structure features an amide-linked benzamide group attached to a phenylboronic acid moiety, making it a key building block in the synthesis of boronic acid-containing compounds for research and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 397843-80-0
N-(4-(BENZOYLAMINO)PHENYL)BENZAMIDE
research compound
(4-Cyanonaphthalen-1-yl)boronic acid
Pharmaceutical intermediate for boronic acid synthesis
6-Benzyloxypyridine-3-boronic acid
Pharmaceutical intermediate for boronic acid synthesis
(2-BOC-AMINOPHENYL)BORONIC ACID
Pharmaceutical intermediate for boronic acid synthesis
4-(Tetrahydro-2H-pyran-2-yloxy)phenylboronic Acid (contains varying amounts of Anhydride)
Pharmaceutical intermediate for boronic acid synthesis
L-Alanine isopropyl ester hydrochloride
amino acid ester intermediate
Tert-butyl 3-oxoazetidine-1-carboxylate
Pharmaceutical intermediate
(6-fluoropyridin-3-yl)methanol
Pharmaceutical intermediate for anxiolytic synthesis
(4-benzamidophenyl)boronic acid
FWZVIUZIYYIKRK-UHFFFAOYSA-N
B(C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2)(O)O
—