Dimethyl 2-(tert-butyl)malonate is a chemical compound used primarily as a research reagent. Its structure features two ester groups, contributing to its moderate polarity and non-aromatic character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 39520-25-7
Asperosaponin VI
research compound
1,3-Benzenedimethanol, 5,5'-(1-methylethylidene)bis[2-hydroxy-
Research compound for organic synthesis
3-Nitrobenzyl bromide
Organic synthesis reagent
2-Nitrobenzyl bromide
chemical synthesis intermediate
dimethyl 2-tert-butylpropanedioate
OBANUQSDPDUGSL-UHFFFAOYSA-N
CC(C)(C)C(C(=O)OC)C(=O)OC