4-Fluoro-2-nitrobenzoic acid is a fluorinated aromatic carboxylic acid used primarily as a building block in pharmaceutical manufacturing. Its structure combines a carboxylic acid group with a nitro group and a fluorine atom on a benzene ring, making it a valuable intermediate for synthesizing more complex drug compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 394-01-4
5-Fluoro-2-methoxybenzoic acid
Aurora A kinase inhibitor intermediate
2-Bromo-5-fluorobenzoic acid
pharmaceutical intermediate
5'-Fluoro-2'-hydroxyacetophenone
Pharmaceutical intermediate
Methyl 2-fluorobenzoate
dye, pesticide, pharmaceutical intermediates
4-fluoro-2-nitrobenzoic acid
YLUCXHMYRQUERW-UHFFFAOYSA-N
C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)O