This compound is a fluorescent dye characterized by a xanthene core structure with diethylamino substituents and a methyl ester group. It is commonly used as a fluorescent label or tracer due to its bright emission properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 39393-39-0
3,6-Bis(diethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium tetrachlorozincate
Fluorescent solvent dye
3,6-Bis(diethylamino)-9-(2-(ethoxycarbonyl)phenyl)xanthylium chloride
Basic violet pigment
RHODAMINE B
Dye for paper and textiles
Rhodamine B Lake
purple pigment for coloring
Dimethyl 5-sulfoisophthalate sodium salt
sulfonate monomer for polyester dye
4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-1,1'-BIPHENYL
Fluorescent brightener
(1,1'-Bianthracene)-9,9',10,10'-tetrone, 4,4'-diamino-
anthraquinone pigment red 177
4-Chloro-1,8-naphthalic anhydride
Fluorescent solvent dye intermediate
[6-(diethylamino)-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium chloride
WODAOEIFNMQKIS-UHFFFAOYSA-M
CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)OC.[Cl-]