This compound is a fluorinated benzoic acid derivative containing iodine, used as an intermediate in the synthesis of the pharmaceutical agent cobimetinib. It features both carboxylic acid and secondary amine functional groups, contributing to its role in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 391211-97-5
O-(2-(Vinyloxy)ethyl)hydroxylamine
Pharmaceutical intermediate for binimetinib synthesis
(9H-fluoren-9-yl)methyl 4-(aminomethyl)piperidine-1-carboxylate hydrochloride
Pharmaceutical intermediate for peptide synthesis
Isouramil
aglycone of convicine
Spliceostatin A
Spliceostatin A intermediate
3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoic acid
REMYZOSCCVDLDL-UHFFFAOYSA-N
C1=CC(=C(C=C1I)F)NC2=C(C=CC(=C2F)F)C(=O)O