This compound is a fluorinated benzoic acid derivative containing iodine, used as an intermediate in the synthesis of the pharmaceutical agent cobimetinib. It features both carboxylic acid and secondary amine functional groups, contributing to its role in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)benzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
O-(2-(Vinyloxy)ethyl)hydroxylamine
Pharmaceutical intermediate for binimetinib synthesis
(9H-fluoren-9-yl)methyl 4-(aminomethyl)piperidine-1-carboxylate hydrochloride
Pharmaceutical intermediate for peptide synthesis
Isouramil
aglycone of convicine
Spliceostatin A
Spliceostatin A intermediate
3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoic acid
REMYZOSCCVDLDL-UHFFFAOYSA-N
C1=CC(=C(C=C1I)F)NC2=C(C=CC(=C2F)F)C(=O)O
3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)benzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.