8-Aminoadenosine is a purine nucleoside analog featuring an amino group substitution at the 8-position of the adenine base. It is primarily used as a research reagent for studying adenosine receptor interactions and nucleotide metabolism.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
8-Aminoadenosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
8-Bromoadenosine
research compound
4-Fluoroindole
organic synthesis building block
7-fluoro-1H-indole
Reagent for chemical synthesis
Lithium Tri-sec-butylborohydride
Mild reducing agent in organic synthesis
4-methoxybenzylmagnesium chloride
Grignard reagent for organic synthesis
(2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DVGWFQILDUEEGX-UUOKFMHZSA-N
C1=NC(=C2C(=N1)N(C(=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N
8-Aminoadenosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.