Dimethyl(tetrahydro-3,3-diphenyl-2-furylidene)ammonium bromide is a quaternary ammonium salt and a pharmaceutical intermediate. It is primarily used as a building block in the synthesis of pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 37743-18-3
(R)-3-Aminobutanoic Acid
Pharmaceutical intermediate for peptide synthesis
Tert-Butyl 3-(1-hydroxyethyl)piperidine-1-carboxylate
pharmaceutical intermediate
(2R)-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid for peptide synthesis
6-Fluoro-2-methylindanone
Pharmaceutical intermediate for synthesis
(3,3-diphenyloxolan-2-ylidene)-dimethylazanium bromide
QJPXLCQSAFQCBD-UHFFFAOYSA-M
C[N+](=C1C(CCO1)(C2=CC=CC=C2)C3=CC=CC=C3)C.[Br-]