Diethyl 1H-pyrazole-3,5-dicarboxylate is a research compound featuring a pyrazole ring with two ester substituents. Its structure has been confirmed by X-ray crystallography, and it is primarily used as a building block in organic synthesis and laboratory research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 37687-24-4
1,14-Dibromotetradecane
chemical intermediate for synthesis
Tetrafluorosuccinic acid
inhibitor of gluconeogenesis
6-Oxopiperidine-2-carboxylic acid
Bacterial metabolite research compound
Dehydroabietinol
abietane diterpenoid research compound
diethyl 1H-pyrazole-3,5-dicarboxylate
MBWXLICVQZUJOW-UHFFFAOYSA-N
CCOC(=O)C1=CC(=NN1)C(=O)OCC