Mycophenolate sodium is the sodium salt form of mycophenolic acid, an immunosuppressive compound used as a pharmaceutical raw material. It functions as an inhibitor of IMP dehydrogenase (EC 1.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 37415-62-6
Mycophenolate mofetil
immunosuppressive agent
Tacrolimus hydrate
immunosuppressive agent
L-Arginine acetylsalicylate
active pharmaceutical ingredient
Sulfisozole sodium
sulfonamide antibiotic
Amikacin
antibiotic active pharmaceutical ingredient
Acebutolol
active pharmaceutical ingredient
Mycophenolic Acid-d3
Deuterated internal standard for mycophenolic acid
6-[4-hydroxy-7-methyl-3-oxo-6-(trideuterio(113C)methoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid
Isotopically labeled active pharmaceutical ingredient
sodium (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate
DOZYTHNHLLSNIK-JOKMOOFLSA-M
CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)[O-])O.[Na+]