This compound is a polycyclic aromatic diketone derivative featuring four fused rings and two lactone (ester) groups, giving it a rigid, highly conjugated structure with no hydrogen bond donors. It is primarily encountered as a laboratory chemical used in synthetic organic chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3711-01-1
[2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone
GIFXHNWKMSFJET-UHFFFAOYSA-N
C1=C2C=C3C(=CC2=CC4=C1C(=O)OC4=O)C(=O)OC3=O
—