This compound is a deuterated form of diphenylamine, where all ten hydrogen atoms on the two aromatic rings are replaced by deuterium. It is primarily used as a reference standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DIPHENYLAMINE (DIPHENYL-D10, 98%) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Adenosine-2',3'-cyclic Monophosphate Sodium Salt
biochemical research reagent
2-Chloro-1,3-dimethylimidazolinium chloride
research reagent and synthetic intermediate
4-Fluorothiophenol
research compound
Alpha-Hydroxytriazolam
triazolobenzodiazepine metabolite
Diphenylamine
Rubber antioxidant and stabilizer
2,3,4,5,6-pentadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)aniline
DMBHHRLKUKUOEG-LHNTUAQVSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])NC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H]
DIPHENYLAMINE (DIPHENYL-D10, 98%) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.