Cinnamoylhydroxamic acid is a chemical compound used as a pharmaceutical intermediate in the manufacturing of active pharmaceutical ingredients. It contains an amide functional group and an aromatic ring, contributing to its role in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cinnamoylhydroxamic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-CHLORO-4-FLUOROANILINE
Pharmaceutical intermediate for synthesis
4-Chloro-3-fluoroaniline
Pharmaceutical intermediate
4-Bromo-2-fluoroaniline
Pharmaceutical intermediate for drug synthesis
2,4-DIFLUOROANILINE
Chemical intermediate for pharmaceutical synthesis
(E)-N-hydroxy-3-phenylprop-2-enamide
UVDDFTZLVFIQFL-VOTSOKGWSA-N
C1=CC=C(C=C1)/C=C/C(=O)NO
Cinnamoylhydroxamic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.