Arginine ethyl ester hydrochloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients. It is the hydrochloride salt form of L-arginine ethyl ester, a derivative of the amino acid arginine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 36589-29-4
Cis-N1-(tert-Butoxycarbonyl)-1,2-cyclohexanediamine
Pharmaceutical intermediate for chiral synthesis
Ethyl (1S,3R,4R)-3-{[(tert-butoxy)carbonyl]amino}-4-hydroxycyclohexane-1-carboxylate
Pharmaceutical intermediate for drug synthesis
1,1-Dimethylethyl N-[(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate
Pharmaceutical intermediate for edoxaban synthesis
3-Fluoro-4-methoxyaniline
pharmaceutical intermediate
ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride
DUCUWLZKZPQJDY-RGMNGODLSA-N
CCOC(=O)[C@H](CCCN=C(N)N)N.Cl