This compound is a chlorinated heterocyclic ester used as a pharmaceutical intermediate in the synthesis of nucleoside analogs. Its structure features multiple aromatic rings, ester linkages, and halogen substituents, contributing to its role in specialized organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3601-90-9
Hoffer's chlorosugar
intermediate for nucleoside synthesis
1-Chloro-3,5-di-O-toluoyl-2-deoxy-D-ribofuranose
Nucleoside synthesis intermediate
1,2-O-(1-methylethylidene)-4-C-[(phenylmethoxy)methyl]-3-O-(phenylmethyl)-L-Lyxofuranose
Pharmaceutical intermediate for nucleoside synthesis
((3aR,4R,6R,6aR)-2,2-Dimethyl-6-(2-oxo-4-(1H-1,2,4-triazol-1-yl)pyrimidin-1(2H)-yl)tetrahydro-2H-furo(3,4-d)(1,3)dioxol-4-yl)methyl 2-methylpropanoate
Pharmaceutical intermediate for nucleoside synthesis
N-Benzoyl-2'-deoxyadenosine
Pharmaceutical intermediate for nucleoside synthesis
Tert-Butyl N-hydroxycarbamate
pharmaceutical intermediate
Methyl 6-aminonicotinate
Pharmaceutical intermediate for drug synthesis
Methyl 6-aminopyridine-2-carboxylate
Pharmaceutical intermediate
[(2R,3S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate
QEHCZULNFYDPPL-RTKIROINSA-N
C1[C@@H]([C@H](OC1Cl)COC(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=CC=C(C=C3)Cl