N-Boc-D-glutamic acid 5-benzyl ester is a protected amino acid derivative used as an intermediate in peptide synthesis. Its structure incorporates a tert-butyloxycarbonyl (Boc) protecting group on the amino function and a benzyl ester on the side-chain carboxyl, enabling selective deprotection strategies during the assembly of peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 35793-73-8
5-tert-Butyl N-((phenylmethoxy)carbonyl)-L-glutamate
Protected amino acid for peptide synthesis
Z-d-glu(otbu)-oh
Protected amino acid for peptide synthesis
5-benzyl 1-(tert-butyl) ((benzyloxy)carbonyl)-L-glutamate
Protected glutamic acid derivative
Tert-butyl N-[1-(hydroxymethyl)cyclopropyl]carbamate
peptide synthesis protecting group intermediate
Trifluoromethyl trifluoromethanesulfonate
trifluoromethylating reagent in organic synthesis
1-bromo-2-(diethoxymethyl)benzene
Pharmaceutical intermediate
1,3-dicyclohexyl-2,4,6(1H,3H,5H)-pyrimidinetrione
pharmaceutical intermediate
Ethyltriphenylphosphonium acetate
Pharmaceutical and agrochemical intermediate
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid
AJDUMMXHVCMISJ-CYBMUJFWSA-N
CC(C)(C)OC(=O)N[C@H](CCC(=O)OCC1=CC=CC=C1)C(=O)O