2,5-bis(2,2,2-trifluoroethoxy)benzoic acid is a chemical compound used as a pharmaceutical intermediate in the synthesis of flecainide. It features a benzoic acid core with two trifluoroethoxy substituents, contributing to its role in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 35480-52-5
1-(2,5-bis(2,2,2-trifluoroethoxy)phenyl)ethanone
intermediate for agrochemical or pharmaceutical synthesis
2,2,2-trifluoroethyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate
research compound
Methyl 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylate 1,1-dioxide
pharmaceutical intermediate
2-Propenoic acid, 2-phosphonoxy-, tricyclohexylammonium salt
Phosphoenolpyruvate salt for biochemical research
N-Methyl-D-glucamine Hydrochloride
pharmaceutical intermediate
3-Chloro-1,1-diethoxypropane
pharmaceutical intermediate
2,5-bis(2,2,2-trifluoroethoxy)benzoic acid
YPGYLCZBZKRYQJ-UHFFFAOYSA-N
C1=CC(=C(C=C1OCC(F)(F)F)C(=O)O)OCC(F)(F)F