(R)-2-Azido-2-phenylacetyl chloride is a chiral organic compound featuring an azido group and an acyl chloride group attached to a phenyl ring. It is primarily used as a research reagent for laboratory-scale synthetic investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 35353-41-4
Vinylmagnesium chloride
Grignard reagent for organic synthesis
Selenocystamine dihydrochloride
research reagent
Cyclopentyl bromide-d9
Deuterated chemical research reagent
2,2'-(Carbonothioyldisulfanediyl)bis(2-methylpropanoic acid)
Research chemical for crystallographic studies
(2R)-2-azido-2-phenylacetyl chloride
NRSMVAFUFMOXFI-SSDOTTSWSA-N
C1=CC=C(C=C1)[C@H](C(=O)Cl)N=[N+]=[N-]
—