2-Methoxy-5-(trifluoromethyl)aniline is a research compound used primarily as a laboratory reagent. It is structurally characterized by an aromatic ring with an amine, an ether, and halogen substituents, giving it moderate lipophilicity and polarity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Methoxy-5-(trifluoromethyl)aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3'-(Trifluoromethyl)acetophenone
research compound
4-(Trifluoromethyl)benzyl alcohol
aromatic primary alcohol research reagent
2,5-dichloro-N-(3-methylbutyl)benzamide
Research compound as impurity standard
2-Chloro-4-fluoropyridine
research chemical intermediate
2-methoxy-5-(trifluoromethyl)aniline
RKUSRLUGUVDNKP-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(F)(F)F)N
2-Methoxy-5-(trifluoromethyl)aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.