3-Chloro-2,4,6-trideuteroaniline is a deuterium-labeled derivative of 3-chloroaniline, used as a research reagent in analytical and synthetic chemistry. Its three deuterium atoms enable tracing and quantification in studies such as mass spectrometry or reaction mechanism investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Chloro-2,4,6-trideuteroaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
DL-MEVALONOLACTONE-4,4,5,5,6,6,6-D7
isotopically labeled mevalonolactone standard
L-Ornithine-d6 Hydrochloride
deuterated internal standard for LC-MS
BISPHENOL-A-3,3',5,5'-D4
deuterated analytical reference standard
2-AminoFluorene-D11
stable isotope labeled research reagent
3-CHLOROANILINE
intermediate for herbicides and pesticides
3-chloro-2,4,6-trideuterioaniline
PNPCRKVUWYDDST-NRUYWUNFSA-N
[2H]C1=CC(=C(C(=C1N)[2H])Cl)[2H]
3-Chloro-2,4,6-trideuteroaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.