3-Methylbutyric-d9 acid is a deuterated analytical research standard, where all nine hydrogen atoms in the methyl groups of isovaleric acid are replaced with deuterium. It is primarily used as an internal standard in mass spectrometry and nuclear magnetic resonance spectroscopy to enable accurate quantification of the non-deuterated compound.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-METHYLBUTYRIC-D9 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Aminobiphenyl-d9
deuterated analytical reference standard
2-AMINOBIPHENYL-D9
deuterated research compound
1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic Acid
research compound
4-(Methylthio)benzaldehyde
Research compound
ISOVALERIC ACID
Flavor and fragrance ingredient
2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoic acid
GWYFCOCPABKNJV-CBZKUFJVSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)O
3-METHYLBUTYRIC-D9 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.