1-Bromo-2,3,4,5,6-pentafluorobenzene is a brominated, fully fluorinated aromatic compound used primarily as a research reagent. Its structure consists of a benzene ring with one bromine atom and five fluorine atoms, giving it distinct chemical properties for laboratory applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 344-04-7
1-bromo-2,3,4,5,6-pentafluorobenzene
XEKTVXADUPBFOA-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)Br)F)F)F