This compound is a naturally occurring bicyclic alcohol with a decalin-like skeleton, used primarily as a fragrance ingredient. Its structure features a single hydroxyl group and multiple stereocenters, contributing to its distinct olfactory properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1H-Indene-1-pentanol, octahydro-4-hydroxy-alpha,alpha,epsilon,7a-tetramethyl-, (epsilonR,1R,3aR,4S,7aR)-
pharmaceutical intermediate
3,7-dimethyl-7-methoxyoctan-2-ol
fragrance ingredient
(+)-Borneol
fragrance ingredient
4-Methyl-3-decen-5-ol
fragrance ingredient
Phytol
fragrance ingredient
1-OCTEN-3-OL
Fragrance ingredient for essential oil reconstitution
(Z)-11-Hexadecenyl acetate
pheromone component for insect control
Isobornyl cyclohexanol
Fragrance ingredient
(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol
KJWMQESDDWGHHO-DFBDCSAJSA-N
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CCC[C@@H]2O)C
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.