5'-Thymidylic acid, disodium salt is the sodium salt form of thymidine monophosphate, a nucleotide derivative. It serves as a phosphorylated thymidine compound commonly used as a pharmaceutical intermediate in the synthesis of nucleotide-based products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 33430-62-5
Thymidine 5'-diphosphoric acid trisodium salt
nucleotide diphosphate intermediate
((2R,3S,5R)-3-Hydroxy-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-2-yl)methyl trihydrogen diphosphate disodium salt
nucleotide diphosphate research reagent
Thymidine 5'-triphosphate sodium salt
nucleotide triphosphate research reagent
Thymidine 5'-triphosphate sodium salt
Nucleotide triphosphate for molecular biology
4-[2-(3,4-Dihydro-7-methoxy-4,4-dimethyl-1,3-dioxo-2(1H)-isoquinolinyl)ethyl]benzenesulfonamide
pharmaceutical intermediate
6-Amino-2-methyl-5-nitropyrimidin-4(1H)-one
pharmaceutical intermediate
3-nitropyridine-2,6-diamine
Pharmaceutical intermediate
(3S)-piperidin-3-amine dihydrochloride
Pharmaceutical intermediate
disodium;[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate
AGSQMPPRYZYDFV-ZJWYQBPBSA-L
CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COP(=O)([O-])[O-])O.[Na+].[Na+]