3,5-Dichloro-4-hydroxybenzoic acid is a chlorinated aromatic carboxylic acid used primarily as a research reagent. It features a phenolic hydroxyl group and two chlorine substituents on the benzene ring, which contribute to its chemical properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3336-41-2
Lipid Membrane Translocating Peptide
Cell-penetrating peptide tool
Spermidine trihydrochloride
biochemical research reagent
Pyrazinetetracarbonitrile
research reagent
11-Phenylundecanoic acid
Research compound for lipid studies
3,5-dichloro-4-hydroxybenzoic acid
AULKDLUOQCUNOK-UHFFFAOYSA-N
C1=C(C=C(C(=C1Cl)O)Cl)C(=O)O