Methyl (2R,3S)-N-benzoylphenylisoserinate is a pharmaceutical intermediate specifically used in the manufacturing process of the taxol side chain. This compound features a complex aromatic structure with alcohol and amide functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 32981-85-4
Ethyl (I+-R,I2S)-I2-(benzoylamino)-I+--hydroxybenzenepropanoate
pharmaceutical intermediate synthesis
10-Deacetylbaccatin III
Precursor to anti-cancer drug docetaxel
(1S)-2-chloro-1-(2,4-difluorophenyl)ethanol
pharmaceutical intermediate
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
1-(triphenylmethyl)-1H-imidazole-4-carbaldehyde
pharmaceutical intermediate
(2R,3S)-N-Benzoyl-3-phenylisoserine
Pharmaceutical intermediate for taxol synthesis
4-[[(5-Fluoro-2-methoxybenzoyl)amino]methyl]benzoic acid
Pirtobrutinib intermediate
N-(4-(2,2-Dicyano-1-hydroxyvinyl)benzyl)-5-fluoro-2-methoxybenzamide
Pharmaceutical intermediate
methyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate
UYJLJICUXJPKTB-LSDHHAIUSA-N
COC(=O)[C@@H]([C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)O