This compound is a benzimidazole derivative used primarily as a research compound. Its structure includes an amide and an amine functional group, contributing to its properties as a laboratory reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 328543-09-5
Benzeneacetic acid, 4-(trifluoromethyl)-
research compound
Benzylamine hydrochloride
pharmaceutical research intermediate
Diphenyl[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine oxide
research compound
(4-(2-(Azepan-1-yl)ethoxy)phenyl)methanol hydrochloride
Research compound
2-[4-[(dimethylamino)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one
SEKJSSBJKFLZIT-UHFFFAOYSA-N
CN(C)CC1=CC=C(C=C1)C2=NC3=CC=CC4=C3N2CCNC4=O