2,5-Bis(trifluoromethyl)aniline is a fluorinated aromatic amine compound used primarily as a pharmaceutical intermediate. Its structure features an aniline core with two trifluoromethyl groups, imparting distinct physicochemical properties such as moderate lipophilicity and low polar surface area.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 328-93-8
Methyl 4-chloroacetoacetate
pharmaceutical intermediate
(4R)-N-(tert-Butyloxycarbonyl)-4-(cyanomethyl)-L-glutamic Acid 1,5-Dimethyl Ester
Pharmaceutical intermediate
Methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate
Pharmaceutical intermediate for antiviral synthesis
2,1,3-benzoxadiazole-4-carbaldehyde
pharmaceutical intermediate
2,5-bis(trifluoromethyl)aniline
XWMVIJUAZAEWIE-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)N)C(F)(F)F