N4-Hydroxycytidine is a research compound used for RNA modification. It is a modified nucleoside characterized by a hydroxyamino group at the N4 position of the cytosine base, with high polarity and multiple hydrogen bond donors and acceptors, indicating potential for biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N4-Hydroxycytidine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Phenylbenzoselenazole
Research reagent for selenium chemistry
2-chlorooxazolo[4,5-b]pyridine
research reagent
4,4,4-Trifluoro-1-phenyl-1,3-butanedione
trapping reactive metabolites of carcinogens
(L)-3-(PROPARGYLSULFENYL)-ALANINE
research compound
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one
XCUAIINAJCDIPM-XVFCMESISA-N
C1=CN(C(=O)N=C1NO)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O
N4-Hydroxycytidine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.