Melphalan hydrochloride is a bifunctional alkylating agent and a phenylalanine derivative of nitrogen mustard. It is converted into reactive intermediates that form crosslinks with DNA, inhibiting RNA transcription and protein synthesis, leading to cell growth arrest.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Melphalan hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
멜팔란
active pharmaceutical ingredient
L-Ornithine L-aspartate
amino acid based active pharmaceutical ingredient
N6-Hydroxymethyl Adefovir Dipivoxil
prodrug of adefovir
Sisomicin
aminoglycoside antibiotic
2-Methyl-ethinylestradiol
Active pharmaceutical ingredient
(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;hydrochloride
OUUYBRCCFUEMLH-YDALLXLXSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)N(CCCl)CCCl.Cl
Melphalan hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.