1,2-Difluoro-4-(trifluoromethyl)benzene is a fluorinated aromatic compound used primarily as an industrial chemical intermediate. Its structure features a benzene ring substituted with two fluorine atoms and a trifluoromethyl group, contributing to its hydrophobic and stable properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2-Difluoro-4-(trifluoromethyl)benzene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Magnesium 2-methylpropan-2-olate
Base in organic synthesis
Cyclohexane, 1-isocyanato-4-methyl-, trans-
aliphatic isocyanate monomer
(3,4-Dichlorophenyl)acetonitrile
chemical intermediate
N-Phenyl-[1,1'-biphenyl]-4-amine
industrial chemical intermediate
1,2-difluoro-4-(trifluoromethyl)benzene
MVCGQTYWLZSKSB-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)F)F
1,2-Difluoro-4-(trifluoromethyl)benzene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.