1,2-Cyclohexanedimethanol, (1S,2S)- is a chiral diol compound used as a pharmaceutical intermediate. It features two alcohol functional groups and a saturated cyclohexane ring, making it suitable for use in organic synthesis and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2-Cyclohexanedimethanol, (1S,2S)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(R)-tert-Butyl 3-(((benzyloxy)carbonyl)amino)piperidine-1-carboxylate
Pharmaceutical intermediate for piperidine derivatives
3,5-Difluorobenzaldehyde
pharmaceutical synthesis intermediate
2-Fluoro-5-methylbenzoic acid
Pharmaceutical intermediate
ADENINE SULFATE
pharmaceutical intermediate
(1R,2R)-1,2-Cyclohexanedimethanol
Pharmaceutical intermediate
[(1S,2S)-2-(hydroxymethyl)cyclohexyl]methanol
XDODWINGEHBYRT-HTQZYQBOSA-N
C1CC[C@@H]([C@H](C1)CO)CO
1,2-Cyclohexanedimethanol, (1S,2S)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.