2-Fluoro-3-nitrobenzoic acid is a fluorinated aromatic carboxylic acid commonly used as a pharmaceutical intermediate in the synthesis of drug compounds. Its structure includes both a nitro group and a fluorine atom on a benzoic acid ring, contributing to its reactivity in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 317-46-4
5-Chloromethyl-4-methyl-2-(4-trifluoromethyl-phenyl)-thiazole
pharmaceutical intermediate
Adrenaline EP Impurity E HCl
pharmaceutical reference impurity
2-methyl-4-[(2-methylbenzoyl)amino]Benzoic acid
Tolvaptan intermediate
(1,1'-Biphenyl)-4-carboxylic acid, (3aR,4S,5R,6aS)-hexahydro-4-(hydroxymethyl)-2-oxo-2H-cyclopenta(b)furan-5-yl ester
Pharmaceutical intermediate for prostaglandin synthesis
2-fluoro-3-nitrobenzoic acid
WLGUSLGYTNJJFV-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])F)C(=O)O