2-Propenoic acid, 2-methyl-, 4-hydroxyphenyl ester is an organic compound consisting of a methacrylate ester linked to a hydroxyphenyl group. It serves as a monomer for polymer synthesis, enabling the production of functionalized polymers.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 31480-93-0
Decyl methacrylate
monomer for polymer synthesis
1-isopropylcyclohexyl Methacrylate
monomer for polymer synthesis
BENZYL METHACRYLATE
monomer for polymer synthesis
2-Propenoic acid, 2-methyl-, 1-ethylcyclopentyl ester (9CI, ACI)
monomer for polymer synthesis
Methyl 4-chlorobutyrate
chemical intermediate for synthesis
2,4-Dibromotoluene
organic synthesis intermediate
Neodecanoic acid, sodium salt
Surfactant and lubricant additive
Tris(2,4-di-tert-butylphenyl) phosphite
antioxidant for plastics
(4-hydroxyphenyl) 2-methylprop-2-enoate
PJMXUSNWBKGQEZ-UHFFFAOYSA-N
CC(=C)C(=O)OC1=CC=C(C=C1)O