2'-C-Methyluridine is a synthetic nucleoside analog where a methyl group is attached to the 2' carbon of the ribose sugar. It is structurally related to the natural pyrimidine nucleoside 5-methyluridine but features a modified ribose backbone, making it valuable as an intermediate in the production of nucleoside-based pharmaceuticals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2'-C-methyluridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2'R)-2'-Deoxy-2'-fluoro-2'-methyluridine
Pharmaceutical intermediate for sofosbuvir synthesis
2'-DEOXYURIDINE
nucleoside pharmaceutical intermediate
1-tert-butyl 3-methyl (3S)-piperazine-1,3-dicarboxylate
Pharmaceutical intermediate
Tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate
pharmaceutical intermediate
1-BENZYL 2-METHYL (2S)-PIPERAZINE-1,2-DICARBOXYLATE
pharmaceutical intermediate
N-(3-Chloro-4-fluorophenyl)-6-nitro-7-[[(3S)-tetrahydro-3-furanyl]oxy]-4-quinazolinamine
pharmaceutical intermediate
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione
NBKORJKMMVZAOZ-VPCXQMTMSA-N
C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O)O
2'-C-methyluridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.