This compound is a polycyclic research reagent containing a triazatetracyclic framework with an ester functional group. It is characterized by a moderate lipophilicity and a single hydrogen bond donor, reflecting its potential utility in laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Chloro-4,6-dimethoxy-1,3,5-triazine
amide coupling reagent
Piperazine-2,2,3,3,5,5,6,6-d8 dihydrochloride
deuterated research standard compound
3,5-dichloro-4-methylpyridin-2-amine
Research compound
Reychler's acid
resolution of optically active isomers
ethyl 3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15)-tetraene-12-carboxylate
IIOWSVKQLNZUKM-UHFFFAOYSA-N
CCOC(=O)N1CCC2=C(C1)C3=C4N2CC(=O)NC4=CC=C3
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.