4-Fluorobenzylzinc chloride is an organometallic reagent used in chemical synthesis. It is commonly employed as a nucleophilic coupling partner in cross-coupling reactions to introduce the 4-fluorobenzyl group into target molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Fluorobenzylzinc chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Fluorobenzylmagnesium chloride
Grignard reagent for organic synthesis
2-Fluorophenylmagnesium bromide
organometallic reagent for synthesis
Lithium magnesium chloride 2,2,6,6-tetramethylpiperidin-1-ide (1/1/2/1)
organometallic reagent for synthesis
Lithium n-butylcyclopentadienide
organometallic reagent for synthesis
3-methoxybenzylzinc chloride
organozinc reagent for cross-coupling reactions
4-methylbenzylzinc chloride
organozinc reagent for cross-coupling
Diglyme nickel dibromide
research reagent for coupling reactions
Barium pentafluorobenzenesulphonate
research compound
chlorozinc(1+);1-fluoro-4-methanidylbenzene
HEXMIUITECMJJV-UHFFFAOYSA-M
[CH2-]C1=CC=C(C=C1)F.Cl[Zn+]
4-Fluorobenzylzinc chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.