Methyl chenodeoxycholate is a methyl ester derivative of chenodeoxycholic acid, a naturally occurring bile acid. It serves as a pharmaceutical intermediate in the synthesis of modified bile acid derivatives for research and manufacturing applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3057-04-3
Chenodeoxycholic acid
bile acid for dissolving gallstones
Allochenodeoxycholic acid
cholanoid
4-tert-Butyl hydrogen L-aspartate
Pharmaceutical intermediate
N-Benzoyl-2'-deoxyadenosine
Pharmaceutical intermediate for nucleoside synthesis
Perfluorodecalin
artificial blood substitute component
5-Nitropicolinic acid
Pharmaceutical intermediate
methyl (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
GRQROVWZGGDYSW-IFJDUOSNSA-N
C[C@H](CCC(=O)OC)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C