Phenyltrimethoxysilane is an organosilicon compound containing a phenyl group and three methoxy groups attached to silicon, giving it both aromatic and silicon-based reactivity. It is used as a surface treatment agent, a chemical intermediate, and a laboratory reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2996-92-1
trimethoxy(phenyl)silane
ZNOCGWVLWPVKAO-UHFFFAOYSA-N
CO[Si](C1=CC=CC=C1)(OC)OC