Butanedioic acid, dodecenyl- is an industrial chemical used primarily as a surfactant intermediate and corrosion inhibitor. Structurally, it is a dicarboxylic acid with a long hydrocarbon chain, which contributes to its amphiphilic properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 29658-97-7
Methyl 4-(trifluoromethyl)benzoate
chemical intermediate
Methyl 5-bromopyridine-3-carboxylate
Chemical intermediate for synthesis
Bis(2-ethylhexyl) hydrogen phosphate
metal extractant and lubricant additive
2-Propanol, 1-(1-methyl-2-propoxyethoxy)-
Industrial solvent for cleaning and coatings
2-[(E)-dodec-1-enyl]butanedioic acid
QDCPNGVVOWVKJG-VAWYXSNFSA-N
CCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O